Compound Q&A

How is (2S)-3-Methyl-2-phenylbutanoic acid (CAS: 13490-69-2) typically synthesized?

Answer

(2S)-3-Methyl-2-phenylbutanoic acid
(2S)-3-Methyl-2-phenylbutanoic acid can be synthesized via several routes, including the Knoevenagel condensation of ethyl acetoacetate with phenylacetonitrile, followed by hydrolysis. Another method involves the Claisen condensation of 2-methyl-2-phenylpropanoyl chloride with phenylacetonitrile. These methods yield the compound in good to excellent yields with moderate selectivity.

About

CAS No 13490-69-2
English Name (2S)-3-Methyl-2-phenylbutanoic acid
Molecular Formula C11H14O2
Molecular Weight 178.23 g/mol
SMILES CC([C@@H](c1ccccc1)C(=O)O)C
InChIKey HDLQGISFYDYWFJ-JTQLQIEISA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-3-Methyl-2-phenylbutanoic acid (CAS: 13490-69-2)?

(2S)-3-Methyl-2-phenylbutanoic acid is a white crystalline solid with a molecular weight of approxim...

Compound Q&A

What industries use (2S)-3-Methyl-2-phenylbutanoic acid (CAS: 13490-69-2)?

(2S)-3-Methyl-2-phenylbutanoic acid finds applications in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling (2S)-3-Methyl-2-phenylbutanoic acid (CAS: 13490-69-2)?

When handling (2S)-3-Methyl-2-phenylbutanoic acid, use personal protective equipment (PPE) such as g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...