Compound Q&A

What industries use 2-Chloro-5-methoxynicotinic acid (CAS: 74650-71-8)?

Answer

2-Chloro-5-methoxynicotinic acid
2-Chloro-5-methoxynicotinic acid is primarily used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It is also used in the production of some agricultural chemicals and in the development of sensors.

About

CAS No 74650-71-8
English Name 2-Chloro-5-methoxynicotinic acid
Molecular Formula C7H6ClNO3
Molecular Weight 187.58 g/mol
SMILES COC1=CC(=C(N=C1)Cl)C(=O)O
InChIKey AJKXOHPNDQHYDM-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-5-methoxynicotinic acid (CAS: 74650-71-8)?

2-Chloro-5-methoxynicotinic acid is a crystalline solid with a molecular weight of approximately 192...

Compound Q&A

How is 2-Chloro-5-methoxynicotinic acid (CAS: 74650-71-8) typically synthesized?

2-Chloro-5-methoxynicotinic acid is commonly synthesized through the chlorination of 5-methoxynicoti...

Compound Q&A

What precautions should be taken when handling 2-Chloro-5-methoxynicotinic acid (CAS: 74650-71-8)?

When handling 2-Chloro-5-methoxynicotinic acid, it is important to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...