Compound Q&A

How is 2-Chloro-5-methoxynicotinic acid (CAS: 74650-71-8) typically synthesized?

Answer

2-Chloro-5-methoxynicotinic acid
2-Chloro-5-methoxynicotinic acid is commonly synthesized through the chlorination of 5-methoxynicotinic acid. This process typically involves the use of thionyl chloride as a chlorinating agent, followed by purification through recrystallization from a suitable solvent.

About

CAS No 74650-71-8
English Name 2-Chloro-5-methoxynicotinic acid
Molecular Formula C7H6ClNO3
Molecular Weight 187.58 g/mol
SMILES COC1=CC(=C(N=C1)Cl)C(=O)O
InChIKey AJKXOHPNDQHYDM-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-5-methoxynicotinic acid (CAS: 74650-71-8)?

2-Chloro-5-methoxynicotinic acid is a crystalline solid with a molecular weight of approximately 192...

Compound Q&A

What industries use 2-Chloro-5-methoxynicotinic acid (CAS: 74650-71-8)?

2-Chloro-5-methoxynicotinic acid is primarily used in the pharmaceutical industry as an intermediate...

Compound Q&A

What precautions should be taken when handling 2-Chloro-5-methoxynicotinic acid (CAS: 74650-71-8)?

When handling 2-Chloro-5-methoxynicotinic acid, it is important to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...