Compound Q&A

What precautions should be taken when handling Iron tetraphenylporphine (CAS: 16591-56-3)?

Answer

Iron tetraphenylporphine
When handling Iron tetraphenylporphine (CAS: 16591-56-3), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood due to its potential volatility. Spills should be handled carefully, and cleaning should be done with appropriate solvents. Always consult the Safety Data Sheet (SDS) for specific guidelines and emergency procedures.

About

CAS No 16591-56-3
English Name Iron tetraphenylporphine
Molecular Formula C44H28FeN4
Molecular Weight 668.6 g/mol
SMILES C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)[N-]3.[Fe+2]
InChIKey ZWYCMWUUWAFXIA-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Iron tetraphenylporphine (CAS: 16591-56-3)?

Iron tetraphenylporphine (CAS: 16591-56-3) is a crystalline compound with a molecular weight of appr...

Compound Q&A

How is Iron tetraphenylporphine (CAS: 16591-56-3) typically synthesized?

Iron tetraphenylporphine (CAS: 16591-56-3) is usually synthesized by the reaction of iron(II) chlori...

Compound Q&A

What industries use Iron tetraphenylporphine (CAS: 16591-56-3)?

Iron tetraphenylporphine (CAS: 16591-56-3) is used in various industries including pharmaceuticals f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...