Compound Q&A

What are the physical and chemical properties of Iron tetraphenylporphine (CAS: 16591-56-3)?

Answer

Iron tetraphenylporphine
Iron tetraphenylporphine (CAS: 16591-56-3) is a crystalline compound with a molecular weight of approximately 557.27 g/mol. It is poorly soluble in water but soluble in organic solvents. Chemically, it is known for its ability to act as a Lewis acid and its role as an electron-donating ligand. It exhibits high reactivity towards coordination chemistry and redox properties.

About

CAS No 16591-56-3
English Name Iron tetraphenylporphine
Molecular Formula C44H28FeN4
Molecular Weight 668.6 g/mol
SMILES C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)[N-]3.[Fe+2]
InChIKey ZWYCMWUUWAFXIA-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

How is Iron tetraphenylporphine (CAS: 16591-56-3) typically synthesized?

Iron tetraphenylporphine (CAS: 16591-56-3) is usually synthesized by the reaction of iron(II) chlori...

Compound Q&A

What industries use Iron tetraphenylporphine (CAS: 16591-56-3)?

Iron tetraphenylporphine (CAS: 16591-56-3) is used in various industries including pharmaceuticals f...

Compound Q&A

What precautions should be taken when handling Iron tetraphenylporphine (CAS: 16591-56-3)?

When handling Iron tetraphenylporphine (CAS: 16591-56-3), it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...