Compound Q&A

What industries use 4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2)?

Answer

4-Chlorophenylalanine hydrochloride (1:1)
4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2) is used in the pharmaceutical industry for the synthesis of certain drugs, in the polymer industry for the production of specialty polymers, and in the semiconductor industry for the development of sensors and other electronic components. It also finds applications in research and development for its unique chemical properties.

About

English Name 4-Chlorophenylalanine hydrochloride (1:1)
Molecular Formula C9H11Cl2NO2
Molecular Weight 236.1 g/mol
SMILES C1=CC(=CC=C1CC(C(=O)O)N)Cl.Cl
InChIKey PFOCEDBJFKVRHU-DDWIOCJRSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2)?

4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2) is a white crystalline powder. Its molecular ...

Compound Q&A

How is 4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2) typically synthesized?

4-Chlorophenylalanine hydrochloride can be synthesized by reacting 4-chloroaniline with phenylacetic...

Compound Q&A

What precautions should be taken when handling 4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2)?

When handling 4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2), it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...