Compound Q&A

How is 4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2) typically synthesized?

Answer

4-Chlorophenylalanine hydrochloride (1:1)
4-Chlorophenylalanine hydrochloride can be synthesized by reacting 4-chloroaniline with phenylacetic acid in the presence of a suitable acid catalyst, such as sulfuric acid, followed by recrystallization from water or an aqueous solution to obtain the desired hydrochloride salt. The reaction yields are generally high, and the product can be isolated with good purity.

About

English Name 4-Chlorophenylalanine hydrochloride (1:1)
Molecular Formula C9H11Cl2NO2
Molecular Weight 236.1 g/mol
SMILES C1=CC(=CC=C1CC(C(=O)O)N)Cl.Cl
InChIKey PFOCEDBJFKVRHU-DDWIOCJRSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2)?

4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2) is a white crystalline powder. Its molecular ...

Compound Q&A

What industries use 4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2)?

4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2) is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2)?

When handling 4-Chlorophenylalanine hydrochloride (CAS: 147065-05-2), it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...