Compound Q&A

What industries use 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole (CAS: 882562-40-5)?

Answer

3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole
3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole is primarily used in the pharmaceutical and sensor industries. It serves as a crucial intermediate in the synthesis of novel drugs and is also employed in the development of chemical sensors for detecting various analytes. Its unique chemical properties make it valuable in these applications.

About

English Name 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole
Molecular Formula C18H11Cl2N3O2S
Molecular Weight 404.28 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=CC=CC=C32)C4=NC(=NC=C4Cl)Cl
InChIKey ZSDGZYGEBQECGY-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole (CAS: 882562-40-5)?

The compound 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole is a crystalline solid with...

Compound Q&A

How is 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole (CAS: 882562-40-5) typically synthesized?

3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole is commonly synthesized through a multi-...

Compound Q&A

What precautions should be taken when handling 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole (CAS: 882562-40-5)?

When handling 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole, it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...