Compound Q&A

What are the physical and chemical properties of 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole (CAS: 882562-40-5)?

Answer

3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole
The compound 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole is a crystalline solid with a high molecular weight. It has a low solubility in water but is more soluble in organic solvents such as DMF and THF. The compound shows moderate reactivity towards nucleophiles and electrophiles. Its physicochemical properties make it suitable for use in the synthesis of pharmaceuticals and sensors.

About

English Name 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole
Molecular Formula C18H11Cl2N3O2S
Molecular Weight 404.28 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=CC=CC=C32)C4=NC(=NC=C4Cl)Cl
InChIKey ZSDGZYGEBQECGY-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

How is 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole (CAS: 882562-40-5) typically synthesized?

3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole is commonly synthesized through a multi-...

Compound Q&A

What industries use 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole (CAS: 882562-40-5)?

3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole (CAS: 882562-40-5)?

When handling 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole, it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...