Compound Q&A

How is 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole (CAS: 882562-40-5) typically synthesized?

Answer

3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole
3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole is commonly synthesized through a multi-step reaction involving the condensation of 2,5-dichloropyrimidine with phenylsulfonyl isocyanate, followed by amination. Various catalysts such as triethylamine and catalytic amounts of HOBt can be used to improve the yield and selectivity. This compound is often used as a key intermediate in the development of new pharmaceuticals.

About

English Name 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole
Molecular Formula C18H11Cl2N3O2S
Molecular Weight 404.28 g/mol
SMILES C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=CC=CC=C32)C4=NC(=NC=C4Cl)Cl
InChIKey ZSDGZYGEBQECGY-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole (CAS: 882562-40-5)?

The compound 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole is a crystalline solid with...

Compound Q&A

What industries use 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole (CAS: 882562-40-5)?

3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole (CAS: 882562-40-5)?

When handling 3-(2,5-Dichloropyrimidin-4-yl)-1-(phenylsulfonyl)-1H-indole, it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...