Compound Q&A

What precautions should be taken when handling 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid (CAS: 174267-71-1)?

Answer

2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid
Handling 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid requires the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate absorbent materials and handled according to the safety data sheet (SDS). Always refer to the latest SDS for detailed safety information.

About

English Name 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid
Molecular Formula C30H55N3O10
Molecular Weight 617.77 g/mol
SMILES OC(=O)CN(CCN(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C
InChIKey YOAXKQZNUYOPFL-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid (CAS: 174267-71-1)?

2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid is a white crystalline solid w...

Compound Q&A

How is 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid (CAS: 174267-71-1) typically synthesized?

2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid is typically synthesized throu...

Compound Q&A

What industries use 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid (CAS: 174267-71-1)?

2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid is used in the pharmaceutical ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...