Compound Q&A

What are the physical and chemical properties of 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid (CAS: 174267-71-1)?

Answer

2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid
2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid is a white crystalline solid with a molecular weight of approximately 918.4 g/mol. It has good solubility in water and poor solubility in organic solvents. The compound is reactive due to its amine and carboxylic acid functionalities, making it susceptible to hydrolysis and basic or acidic conditions.

About

English Name 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid
Molecular Formula C30H55N3O10
Molecular Weight 617.77 g/mol
SMILES OC(=O)CN(CCN(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C
InChIKey YOAXKQZNUYOPFL-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

How is 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid (CAS: 174267-71-1) typically synthesized?

2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid is typically synthesized throu...

Compound Q&A

What industries use 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid (CAS: 174267-71-1)?

2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid is used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid (CAS: 174267-71-1)?

Handling 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid requires the use of p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...