Compound Q&A

What industries use 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid (CAS: 174267-71-1)?

Answer

2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid
2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also applied in the polymer industry as a building block for advanced materials. Additionally, it has potential applications in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid
Molecular Formula C30H55N3O10
Molecular Weight 617.77 g/mol
SMILES OC(=O)CN(CCN(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C
InChIKey YOAXKQZNUYOPFL-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid (CAS: 174267-71-1)?

2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid is a white crystalline solid w...

Compound Q&A

How is 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid (CAS: 174267-71-1) typically synthesized?

2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid is typically synthesized throu...

Compound Q&A

What precautions should be taken when handling 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid (CAS: 174267-71-1)?

Handling 2-[bis[2-[bis(2-tert-butoxy-2-oxo-ethyl)amino]ethyl]amino]acetic acid requires the use of p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...