Compound Q&A

What industries use Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3)?

Answer

Ethyl 4-bromo-2-(trifluoromethoxy)benzoate
Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3) finds applications in the pharmaceutical industry for the synthesis of certain drugs. It is also used in the polymer industry as a monomer or intermediate. Additionally, this compound can be used in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name Ethyl 4-bromo-2-(trifluoromethoxy)benzoate
Molecular Formula C10H8BrF3O3
Molecular Weight 299.04 g/mol
SMILES COC(=O)c1ccc(Br)cc1OC(F)(F)F
InChIKey QDAATKCEXCYIPG-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3)?

Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3) is a crystalline compound with a molec...

Compound Q&A

How is Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3) typically synthesized?

Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3) is commonly synthesized via a Friedel-...

Compound Q&A

What precautions should be taken when handling Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3)?

When handling Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...