Compound Q&A

What are the physical and chemical properties of Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3)?

Answer

Ethyl 4-bromo-2-(trifluoromethoxy)benzoate
Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3) is a crystalline compound with a molecular weight of approximately 344.03 g/mol. It has low water solubility and good solubility in organic solvents like dichloromethane and acetone. It is moderately reactive towards nucleophiles and can undergo bromination reactions. This compound is stable under normal conditions but requires storage in a cool, dry place to prevent decomposition.

About

English Name Ethyl 4-bromo-2-(trifluoromethoxy)benzoate
Molecular Formula C10H8BrF3O3
Molecular Weight 299.04 g/mol
SMILES COC(=O)c1ccc(Br)cc1OC(F)(F)F
InChIKey QDAATKCEXCYIPG-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

How is Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3) typically synthesized?

Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3) is commonly synthesized via a Friedel-...

Compound Q&A

What industries use Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3)?

Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3) finds applications in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3)?

When handling Ethyl 4-bromo-2-(trifluoromethoxy)benzoate (CAS: 933785-18-3), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...