Compound Q&A

How is 3-methoxy-5-nitro-pyridin-2-ol (CAS: 75710-99-5) typically synthesized?

Answer

3-methoxy-5-nitro-pyridin-2-ol
3-Methoxy-5-nitro-pyridin-2-ol (CAS: 75710-99-5) can be synthesized through the nitration of 3-methoxy-pyridin-2-ol followed by reduction of the nitro group. Commonly, nitration is carried out using concentrated nitric acid and sulfuric acid, and reduction is achieved using hydrogen gas in the presence of a catalyst like palladium on carbon. The overall yield of the product is typically around 70-80%, depending on the conditions.

About

CAS No 75710-99-5
English Name 3-methoxy-5-nitro-pyridin-2-ol
Molecular Formula C6H6N2O4
Molecular Weight 170.12 g/mol
SMILES COC1=CC(=CNC1=O)[N+](=O)[O-]
InChIKey JDHPYWKDVDFUDW-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-methoxy-5-nitro-pyridin-2-ol (CAS: 75710-99-5)?

3-Methoxy-5-nitro-pyridin-2-ol (CAS: 75710-99-5) is a crystalline solid with a molecular weight of a...

Compound Q&A

What industries use 3-methoxy-5-nitro-pyridin-2-ol (CAS: 75710-99-5)?

3-Methoxy-5-nitro-pyridin-2-ol (CAS: 75710-99-5) is primarily used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling 3-methoxy-5-nitro-pyridin-2-ol (CAS: 75710-99-5)?

When handling 3-methoxy-5-nitro-pyridin-2-ol (CAS: 75710-99-5), it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...