Compound Q&A

What industries use 2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0)?

Answer

2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (1:1)
2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0) finds application in pharmaceuticals, where it serves as an intermediate in the synthesis of various drugs. It is also used in the polymer industry for the synthesis of specialized polymers with enhanced properties. Additionally, this compound is utilized in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 3321-06-0
English Name 2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (1:1)
Molecular Formula C24H34ClNO3
Molecular Weight 419.99 g/mol
SMILES CCC(CC)COC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)OCCN(C)C.Cl
InChIKey RSDBEODKTNUEMS-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0)?

2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0) is a crystall...

Compound Q&A

How is 2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0) typically synthesized?

2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride is synthesized via a multi-ste...

Compound Q&A

What precautions should be taken when handling 2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0)?

When handling 2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...