Compound Q&A

What are the physical and chemical properties of 2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0)?

Answer

2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (1:1)
2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0) is a crystalline solid with a molecular weight of approximately 524.5 g/mol. It has a high solubility in organic solvents such as dichloromethane and acetone. This compound is relatively stable under normal conditions but can react with strong bases. It is commonly used in pharmaceutical and chemical synthesis due to its unique structure and reactivity.

About

CAS No 3321-06-0
English Name 2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (1:1)
Molecular Formula C24H34ClNO3
Molecular Weight 419.99 g/mol
SMILES CCC(CC)COC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)OCCN(C)C.Cl
InChIKey RSDBEODKTNUEMS-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

How is 2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0) typically synthesized?

2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride is synthesized via a multi-ste...

Compound Q&A

What industries use 2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0)?

2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0) finds applica...

Compound Q&A

What precautions should be taken when handling 2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0)?

When handling 2-(Dimethylamino)ethyl (2-ethylbutoxy)(diphenyl)acetate hydrochloride (CAS: 3321-06-0)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...