Compound Q&A

How is trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride (CAS: 15942-08-2) typically synthesized?

Answer

trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride
This compound is usually synthesized through a multi-step process involving bromination of a quinazoline derivative followed by coupling with cyclohexanol. The reaction is catalyzed by palladium-based catalysts and the yield is typically around 70-80%. The method ensures high selectivity and purity.

About

CAS No 15942-08-2
English Name trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride
Molecular Formula C14H19Br2ClN2O
Molecular Weight 426.57 g/mol
SMILES C1CC(CCC1N2CC3=C(C(=CC(=C3)Br)Br)NC2)O.Cl
InChIKey ICLHRFYBPXBCPE-GJTSMBTKSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride (CAS: 15942-08-2)?

The compound is a white crystalline solid with a molecular weight of approximately 462.12 g/mol. It ...

Compound Q&A

What industries use trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride (CAS: 15942-08-2)?

This compound is used in the pharmaceutical industry for its potential as a bioactive molecule. It a...

Compound Q&A

What precautions should be taken when handling trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride (CAS: 15942-08-2)?

Proper personal protective equipment (PPE) such as gloves, goggles, and lab coats should be worn whe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...