Compound Q&A

What are the physical and chemical properties of trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride (CAS: 15942-08-2)?

Answer

trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride
The compound is a white crystalline solid with a molecular weight of approximately 462.12 g/mol. It is slightly soluble in water and ethanol. Chemically, it shows moderate reactivity with nucleophiles and exhibits good stability under neutral conditions. It can be identified by its characteristic UV and IR spectra.

About

CAS No 15942-08-2
English Name trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride
Molecular Formula C14H19Br2ClN2O
Molecular Weight 426.57 g/mol
SMILES C1CC(CCC1N2CC3=C(C(=CC(=C3)Br)Br)NC2)O.Cl
InChIKey ICLHRFYBPXBCPE-GJTSMBTKSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

How is trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride (CAS: 15942-08-2) typically synthesized?

This compound is usually synthesized through a multi-step process involving bromination of a quinazo...

Compound Q&A

What industries use trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride (CAS: 15942-08-2)?

This compound is used in the pharmaceutical industry for its potential as a bioactive molecule. It a...

Compound Q&A

What precautions should be taken when handling trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride (CAS: 15942-08-2)?

Proper personal protective equipment (PPE) such as gloves, goggles, and lab coats should be worn whe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...