Compound Q&A

What industries use Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate (CAS: 99974-66-0)?

Answer

Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate
Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of certain drugs. It is also utilized in the polymer industry for modifying properties of polymers and in the production of sensors and semiconductors due to its unique chemical structure.

About

CAS No 99974-66-0
English Name Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate
Molecular Formula C10H16O5
Molecular Weight 216.23 g/mol
SMILES CCOC(=O)C1(CC(C1)O)C(=O)OCC
InChIKey HCVGFHCQRXXAGH-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate (CAS: 99974-66-0)?

Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate is a crystalline solid at room temperature with a mol...

Compound Q&A

How is Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate (CAS: 99974-66-0) typically synthesized?

Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate can be synthesized via the condensation of 3-hydroxy-...

Compound Q&A

What precautions should be taken when handling Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate (CAS: 99974-66-0)?

When handling Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate, chemical gloves and safety glasses sho...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...