Compound Q&A

How is Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate (CAS: 99974-66-0) typically synthesized?

Answer

Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate
Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate can be synthesized via the condensation of 3-hydroxy-1,1-cyclobutanedicarboxylic acid with diethyl malonate in the presence of a base like sodium hydride. The reaction is typically carried out in anhydrous dimethylformamide (DMF) at room temperature. The yield is usually around 85%, and the reaction is highly selective, producing a pure diester product.

About

CAS No 99974-66-0
English Name Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate
Molecular Formula C10H16O5
Molecular Weight 216.23 g/mol
SMILES CCOC(=O)C1(CC(C1)O)C(=O)OCC
InChIKey HCVGFHCQRXXAGH-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate (CAS: 99974-66-0)?

Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate is a crystalline solid at room temperature with a mol...

Compound Q&A

What industries use Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate (CAS: 99974-66-0)?

Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate is used in various industries, including pharmaceutic...

Compound Q&A

What precautions should be taken when handling Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate (CAS: 99974-66-0)?

When handling Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate, chemical gloves and safety glasses sho...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...