Compound Q&A

What are the physical and chemical properties of Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate (CAS: 99974-66-0)?

Answer

Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate
Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate is a crystalline solid at room temperature with a molecular weight of approximately 188.2 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. Chemically, it is reactive towards nucleophiles and can undergo esterification and ester exchange reactions. It is typically stable under normal storage conditions, but it may decompose under strong acidic or basic conditions.

About

CAS No 99974-66-0
English Name Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate
Molecular Formula C10H16O5
Molecular Weight 216.23 g/mol
SMILES CCOC(=O)C1(CC(C1)O)C(=O)OCC
InChIKey HCVGFHCQRXXAGH-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate (CAS: 99974-66-0) typically synthesized?

Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate can be synthesized via the condensation of 3-hydroxy-...

Compound Q&A

What industries use Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate (CAS: 99974-66-0)?

Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate is used in various industries, including pharmaceutic...

Compound Q&A

What precautions should be taken when handling Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate (CAS: 99974-66-0)?

When handling Diethyl 3-hydroxy-1,1-cyclobutanedicarboxylate, chemical gloves and safety glasses sho...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...