Compound Q&A

How is Methyl 6-bromo-4-chloroquinoline-2-carboxylate (CAS: 887587-50-0) typically synthesized?

Answer

Methyl 6-bromo-4-chloroquinoline-2-carboxylate
Methyl 6-bromo-4-chloroquinoline-2-carboxylate can be synthesized by the reaction of methyl 4-chloroquinoline-2-carboxylate with bromine in the presence of a suitable catalyst. The reaction typically involves the substitution of the chlorine atom with a bromine atom. High selectivity and moderate yields can be achieved under these conditions. The CAS number is 887587-50-0.

About

English Name Methyl 6-bromo-4-chloroquinoline-2-carboxylate
Molecular Formula C11H7BrClNO2
Molecular Weight 300.53900000000004 g/mol
SMILES COC(=O)C1=NC2=C(C=C(C=C2)Br)C(=C1)Cl
InChIKey RHNVVFWLYMUZOZ-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 6-bromo-4-chloroquinoline-2-carboxylate (CAS: 887587-50-0)?

Methyl 6-bromo-4-chloroquinoline-2-carboxylate is a crystalline compound with a molecular weight of ...

Compound Q&A

What industries use Methyl 6-bromo-4-chloroquinoline-2-carboxylate (CAS: 887587-50-0)?

Methyl 6-bromo-4-chloroquinoline-2-carboxylate is primarily used in the pharmaceutical and polymer i...

Compound Q&A

What precautions should be taken when handling Methyl 6-bromo-4-chloroquinoline-2-carboxylate (CAS: 887587-50-0)?

Proper handling of Methyl 6-bromo-4-chloroquinoline-2-carboxylate (CAS: 887587-50-0) requires the us...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...