Compound Q&A

What are the physical and chemical properties of Methyl 6-bromo-4-chloroquinoline-2-carboxylate (CAS: 887587-50-0)?

Answer

Methyl 6-bromo-4-chloroquinoline-2-carboxylate
Methyl 6-bromo-4-chloroquinoline-2-carboxylate is a crystalline compound with a molecular weight of approximately 414.03 g/mol. It is slightly soluble in water but more soluble in organic solvents like dichloromethane. It is a solid at room temperature with a melting point of around 190-195°C. This compound shows low reactivity under normal conditions but can undergo substitution reactions with appropriate nucleophiles. It has a CAS number of 887587-50-0.

About

English Name Methyl 6-bromo-4-chloroquinoline-2-carboxylate
Molecular Formula C11H7BrClNO2
Molecular Weight 300.54 g/mol
SMILES COC(=O)C1=NC2=C(C=C(C=C2)Br)C(=C1)Cl
InChIKey RHNVVFWLYMUZOZ-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is Methyl 6-bromo-4-chloroquinoline-2-carboxylate (CAS: 887587-50-0) typically synthesized?

Methyl 6-bromo-4-chloroquinoline-2-carboxylate can be synthesized by the reaction of methyl 4-chloro...

Compound Q&A

What industries use Methyl 6-bromo-4-chloroquinoline-2-carboxylate (CAS: 887587-50-0)?

Methyl 6-bromo-4-chloroquinoline-2-carboxylate is primarily used in the pharmaceutical and polymer i...

Compound Q&A

What precautions should be taken when handling Methyl 6-bromo-4-chloroquinoline-2-carboxylate (CAS: 887587-50-0)?

Proper handling of Methyl 6-bromo-4-chloroquinoline-2-carboxylate (CAS: 887587-50-0) requires the us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...