Compound Q&A

What are the physical and chemical properties of 5-(Dimethylamino)naphthalene-1-sulfonamide (CAS: 1431-39-6)?

Answer

5-(Dimethylamino)naphthalene-1-sulfonamide
5-(Dimethylamino)naphthalene-1-sulfonamide (CAS: 1431-39-6) is a crystalline compound with a molecular weight of approximately 252.26 g/mol. It has poor water solubility but good solubility in organic solvents like ethanol and acetone. This compound shows basic properties due to its amine group and is known for its stability under normal conditions but can react with strong acids and bases. It is often used in biological and pharmaceutical applications due to its chemical reactivity.

About

CAS No 1431-39-6
English Name 5-(Dimethylamino)naphthalene-1-sulfonamide
Molecular Formula C12H14N2O2S
Molecular Weight 250.32 g/mol
SMILES CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)N
InChIKey TYNBFJJKZPTRKS-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is 5-(Dimethylamino)naphthalene-1-sulfonamide (CAS: 1431-39-6) typically synthesized?

5-(Dimethylamino)naphthalene-1-sulfonamide is typically synthesized through the reaction of naphthol...

Compound Q&A

What industries use 5-(Dimethylamino)naphthalene-1-sulfonamide (CAS: 1431-39-6)?

5-(Dimethylamino)naphthalene-1-sulfonamide (CAS: 1431-39-6) is primarily used in pharmaceuticals for...

Compound Q&A

What precautions should be taken when handling 5-(Dimethylamino)naphthalene-1-sulfonamide (CAS: 1431-39-6)?

When handling 5-(Dimethylamino)naphthalene-1-sulfonamide (CAS: 1431-39-6), it is important to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...