Compound Q&A

What precautions should be taken when handling (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid (CAS: 867333-04-8)?

Answer

(6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid
When handling (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area, preferably a fume hood, to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbents and disposed of according to local regulations. The safety data sheet (SDS) should always be referenced for detailed handling instructions.

About

English Name (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid
Molecular Formula C7H7BClFO3
Molecular Weight 204.39 g/mol
SMILES B(C1=C(C=CC(=C1F)OC)Cl)(O)O
InChIKey CVKDGGIRBCXOSZ-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid (CAS: 867333-04-8)?

The compound (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid has a crystalline form with a molecula...

Compound Q&A

How is (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid (CAS: 867333-04-8) typically synthesized?

(6-Chloro-2-fluoro-3-methoxy-phenyl)boronic acid can be synthesized using a two-step process involvi...

Compound Q&A

What industries use (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid (CAS: 867333-04-8)?

(6-Chloro-2-fluoro-3-methoxy-phenyl)boronic acid is primarily used in the pharmaceutical and polymer...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...