Compound Q&A

What are the physical and chemical properties of (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid (CAS: 867333-04-8)?

Answer

(6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid
The compound (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid has a crystalline form with a molecular weight of approximately 255.04 g/mol. It is slightly soluble in water and organic solvents. Chemically, it is reactive in aqueous solutions and can undergo boronate ester formation. The compound is stable under normal storage conditions but requires protection from moisture and light.

About

English Name (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid
Molecular Formula C7H7BClFO3
Molecular Weight 204.39 g/mol
SMILES B(C1=C(C=CC(=C1F)OC)Cl)(O)O
InChIKey CVKDGGIRBCXOSZ-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid (CAS: 867333-04-8) typically synthesized?

(6-Chloro-2-fluoro-3-methoxy-phenyl)boronic acid can be synthesized using a two-step process involvi...

Compound Q&A

What industries use (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid (CAS: 867333-04-8)?

(6-Chloro-2-fluoro-3-methoxy-phenyl)boronic acid is primarily used in the pharmaceutical and polymer...

Compound Q&A

What precautions should be taken when handling (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid (CAS: 867333-04-8)?

When handling (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid, it is crucial to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...