Compound Q&A

How is (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid (CAS: 867333-04-8) typically synthesized?

Answer

(6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid
(6-Chloro-2-fluoro-3-methoxy-phenyl)boronic acid can be synthesized using a two-step process involving the protection of the methoxy group, followed by boronation with a boronic ester. Commonly, the synthesis involves the use of a palladium catalyst and a phase transfer catalyst. The yield is typically around 70-80%, with good selectivity towards the desired product.

About

English Name (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid
Molecular Formula C7H7BClFO3
Molecular Weight 204.39 g/mol
SMILES B(C1=C(C=CC(=C1F)OC)Cl)(O)O
InChIKey CVKDGGIRBCXOSZ-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid (CAS: 867333-04-8)?

The compound (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid has a crystalline form with a molecula...

Compound Q&A

What industries use (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid (CAS: 867333-04-8)?

(6-Chloro-2-fluoro-3-methoxy-phenyl)boronic acid is primarily used in the pharmaceutical and polymer...

Compound Q&A

What precautions should be taken when handling (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid (CAS: 867333-04-8)?

When handling (6-chloro-2-fluoro-3-methoxy-phenyl)boronic acid, it is crucial to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...