Compound Q&A

What precautions should be taken when handling Mc-MMAE (CAS: 863971-24-8)?

Answer

Mc-MMAE
When handling Mc-MMAE, it is essential to use appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to prevent inhalation. Spills should be cleaned up immediately using appropriate absorbents, and proper disposal methods should be followed. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name Mc-MMAE
Molecular Formula C49H78N6O10
Molecular Weight 911.2 g/mol
SMILES CC[C@@H]([C@H](N(C(=O)[C@H](C(C)C)NC(=O)[C@@H](N(C(=O)CCCCCN1C(=O)C=CC1=O)C)C(C)C)C)[C@@H](CC(=O)N1CCC[C@H]1[C@@H]([C@H](C(=O)N[C@@H]([C@H](c1ccccc1)O)C)C)OC)OC)C
InChIKey UGJOTJHSQWBROP-AXJCKIDNSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of Mc-MMAE (CAS: 863971-24-8)?

Mc-MMAE is a crystalline compound with a molecular weight of approximately 272.29 g/mol. It has a so...

Compound Q&A

How is Mc-MMAE (CAS: 863971-24-8) typically synthesized?

Mc-MMAE can be synthesized via the reaction of methyl methacrylate with a suitable amine, such as 2-...

Compound Q&A

What industries use Mc-MMAE (CAS: 863971-24-8)?

Mc-MMAE is primarily used in the pharmaceutical industry for the synthesis of certain drug candidate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...