Compound Q&A

How is Mc-MMAE (CAS: 863971-24-8) typically synthesized?

Answer

Mc-MMAE
Mc-MMAE can be synthesized via the reaction of methyl methacrylate with a suitable amine, such as 2-methylmorpholine N-oxide (MOMO). The synthesis typically proceeds with the use of a Lewis acid catalyst, such as titanium(IV) isopropoxide, and is carried out under mild conditions. The yield is generally high, and the product has good purity.

About

English Name Mc-MMAE
Molecular Formula C49H78N6O10
Molecular Weight 911.2 g/mol
SMILES CC[C@@H]([C@H](N(C(=O)[C@H](C(C)C)NC(=O)[C@@H](N(C(=O)CCCCCN1C(=O)C=CC1=O)C)C(C)C)C)[C@@H](CC(=O)N1CCC[C@H]1[C@@H]([C@H](C(=O)N[C@@H]([C@H](c1ccccc1)O)C)C)OC)OC)C
InChIKey UGJOTJHSQWBROP-AXJCKIDNSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of Mc-MMAE (CAS: 863971-24-8)?

Mc-MMAE is a crystalline compound with a molecular weight of approximately 272.29 g/mol. It has a so...

Compound Q&A

What industries use Mc-MMAE (CAS: 863971-24-8)?

Mc-MMAE is primarily used in the pharmaceutical industry for the synthesis of certain drug candidate...

Compound Q&A

What precautions should be taken when handling Mc-MMAE (CAS: 863971-24-8)?

When handling Mc-MMAE, it is essential to use appropriate personal protective equipment (PPE), inclu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...