Compound Q&A

What precautions should be taken when handling (2-Acetamidophenyl)boronic acid (CAS: 169760-16-1)?

Answer

(2-Acetamidophenyl)boronic acid
When handling (2-Acetamidophenyl)boronic acid, it is important to wear appropriate personal protective equipment (PPE), such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to minimize inhalation risks. Spills should be cleaned up immediately with appropriate absorbent materials, and proper disposal methods should be followed. Always refer to the safety data sheet (SDS) for detailed handling and storage information.

About

English Name (2-Acetamidophenyl)boronic acid
Molecular Formula C8H10BNO3
Molecular Weight 178.98 g/mol
SMILES B(C1=CC=CC=C1NC(=O)C)(O)O
InChIKey UMOPBIVXPOETPG-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Acetamidophenyl)boronic acid (CAS: 169760-16-1)?

(2-Acetamidophenyl)boronic acid is a white crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is (2-Acetamidophenyl)boronic acid (CAS: 169760-16-1) typically synthesized?

(2-Acetamidophenyl)boronic acid can be synthesized through the reaction of 2-acetamidophenol with bo...

Compound Q&A

What industries use (2-Acetamidophenyl)boronic acid (CAS: 169760-16-1)?

(2-Acetamidophenyl)boronic acid is primarily used in pharmaceuticals for the synthesis of various co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...