Compound Q&A

What are the physical and chemical properties of (2-Acetamidophenyl)boronic acid (CAS: 169760-16-1)?

Answer

(2-Acetamidophenyl)boronic acid
(2-Acetamidophenyl)boronic acid is a white crystalline solid with a molecular weight of approximately 235.21 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol. This compound is relatively unreactive but can undergo condensation reactions under certain conditions. Its pKa is around 6.9, indicating a weak basic character.

About

English Name (2-Acetamidophenyl)boronic acid
Molecular Formula C8H10BNO3
Molecular Weight 178.98 g/mol
SMILES B(C1=CC=CC=C1NC(=O)C)(O)O
InChIKey UMOPBIVXPOETPG-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is (2-Acetamidophenyl)boronic acid (CAS: 169760-16-1) typically synthesized?

(2-Acetamidophenyl)boronic acid can be synthesized through the reaction of 2-acetamidophenol with bo...

Compound Q&A

What industries use (2-Acetamidophenyl)boronic acid (CAS: 169760-16-1)?

(2-Acetamidophenyl)boronic acid is primarily used in pharmaceuticals for the synthesis of various co...

Compound Q&A

What precautions should be taken when handling (2-Acetamidophenyl)boronic acid (CAS: 169760-16-1)?

When handling (2-Acetamidophenyl)boronic acid, it is important to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...