Compound Q&A

How is (2-Acetamidophenyl)boronic acid (CAS: 169760-16-1) typically synthesized?

Answer

(2-Acetamidophenyl)boronic acid
(2-Acetamidophenyl)boronic acid can be synthesized through the reaction of 2-acetamidophenol with boron tribromide followed by hydrolysis. Alternatively, it can be prepared via the Suzuki coupling reaction of 2-acetamidophenylboronic ester with a suitable coupling partner. The yield is typically high, and the method is known for its good selectivity.

About

English Name (2-Acetamidophenyl)boronic acid
Molecular Formula C8H10BNO3
Molecular Weight 178.98 g/mol
SMILES B(C1=CC=CC=C1NC(=O)C)(O)O
InChIKey UMOPBIVXPOETPG-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Acetamidophenyl)boronic acid (CAS: 169760-16-1)?

(2-Acetamidophenyl)boronic acid is a white crystalline solid with a molecular weight of approximatel...

Compound Q&A

What industries use (2-Acetamidophenyl)boronic acid (CAS: 169760-16-1)?

(2-Acetamidophenyl)boronic acid is primarily used in pharmaceuticals for the synthesis of various co...

Compound Q&A

What precautions should be taken when handling (2-Acetamidophenyl)boronic acid (CAS: 169760-16-1)?

When handling (2-Acetamidophenyl)boronic acid, it is important to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...