Compound Q&A

What industries use Methyl 2,5-difluoro-4-nitrobenzoate (CAS: 924868-81-5)?

Answer

Methyl 2,5-difluoro-4-nitrobenzoate
Methyl 2,5-difluoro-4-nitrobenzoate is utilized in the pharmaceutical industry for the synthesis of certain intermediates and in the polymer industry for the development of functional monomers. It also finds applications in the production of sensors and as a precursor in semiconductor manufacturing processes.

About

English Name Methyl 2,5-difluoro-4-nitrobenzoate
Molecular Formula C8H5F2NO4
Molecular Weight 217.13 g/mol
SMILES COC(=O)C1=CC(=C(C=C1F)[N+](=O)[O-])F
InChIKey XBUVRWIIEREYFL-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,5-difluoro-4-nitrobenzoate (CAS: 924868-81-5)?

Methyl 2,5-difluoro-4-nitrobenzoate is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is Methyl 2,5-difluoro-4-nitrobenzoate (CAS: 924868-81-5) typically synthesized?

Methyl 2,5-difluoro-4-nitrobenzoate is usually synthesized by nitration of 2,5-difluorobenzoic acid ...

Compound Q&A

What precautions should be taken when handling Methyl 2,5-difluoro-4-nitrobenzoate (CAS: 924868-81-5)?

When handling Methyl 2,5-difluoro-4-nitrobenzoate, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...