Compound Q&A

How is Methyl 2,5-difluoro-4-nitrobenzoate (CAS: 924868-81-5) typically synthesized?

Answer

Methyl 2,5-difluoro-4-nitrobenzoate
Methyl 2,5-difluoro-4-nitrobenzoate is usually synthesized by nitration of 2,5-difluorobenzoic acid using nitric acid in a suitable solvent like acetic anhydride. The reaction is typically conducted under reflux conditions. Catalysts such as concentrated sulfuric acid are used to enhance the selectivity and yield of the desired product.

About

English Name Methyl 2,5-difluoro-4-nitrobenzoate
Molecular Formula C8H5F2NO4
Molecular Weight 217.13 g/mol
SMILES COC(=O)C1=CC(=C(C=C1F)[N+](=O)[O-])F
InChIKey XBUVRWIIEREYFL-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2,5-difluoro-4-nitrobenzoate (CAS: 924868-81-5)?

Methyl 2,5-difluoro-4-nitrobenzoate is a crystalline compound with a molecular weight of approximate...

Compound Q&A

What industries use Methyl 2,5-difluoro-4-nitrobenzoate (CAS: 924868-81-5)?

Methyl 2,5-difluoro-4-nitrobenzoate is utilized in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling Methyl 2,5-difluoro-4-nitrobenzoate (CAS: 924868-81-5)?

When handling Methyl 2,5-difluoro-4-nitrobenzoate, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...