Compound Q&A

What are the physical and chemical properties of Methyl 2,5-difluoro-4-nitrobenzoate (CAS: 924868-81-5)?

Answer

Methyl 2,5-difluoro-4-nitrobenzoate
Methyl 2,5-difluoro-4-nitrobenzoate is a crystalline compound with a molecular weight of approximately 262.06 g/mol. It has a high solubility in organic solvents like dichloromethane and methanol. The compound is moderately reactive, showing sensitivity to moisture and heat. It exhibits strong absorption in the UV-visible range, which is typical for nitro compounds.

About

English Name Methyl 2,5-difluoro-4-nitrobenzoate
Molecular Formula C8H5F2NO4
Molecular Weight 217.13 g/mol
SMILES COC(=O)C1=CC(=C(C=C1F)[N+](=O)[O-])F
InChIKey XBUVRWIIEREYFL-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is Methyl 2,5-difluoro-4-nitrobenzoate (CAS: 924868-81-5) typically synthesized?

Methyl 2,5-difluoro-4-nitrobenzoate is usually synthesized by nitration of 2,5-difluorobenzoic acid ...

Compound Q&A

What industries use Methyl 2,5-difluoro-4-nitrobenzoate (CAS: 924868-81-5)?

Methyl 2,5-difluoro-4-nitrobenzoate is utilized in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling Methyl 2,5-difluoro-4-nitrobenzoate (CAS: 924868-81-5)?

When handling Methyl 2,5-difluoro-4-nitrobenzoate, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...