Compound Q&A

What industries use 2-Nitro-3-pyridinol (CAS: 15128-08-2)?

Answer

2-Nitro-3-pyridinol
2-Nitro-3-pyridinol is primarily used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It is also used in the production of some organic pigments and as a precursor in the development of sensors and semiconductors.

About

CAS No 15128-08-2
English Name 2-Nitro-3-pyridinol
Molecular Formula C5H4N2O3
Molecular Weight 140.1 g/mol
SMILES C1=CC(=C(N=C1)[N+](=O)[O-])O
InChIKey QBPDSKPWYWIHGA-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Nitro-3-pyridinol (CAS: 15128-08-2)?

2-Nitro-3-pyridinol (CAS: 15128-08-2) is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is 2-Nitro-3-pyridinol (CAS: 15128-08-2) typically synthesized?

2-Nitro-3-pyridinol is commonly synthesized by the nitration of 3-pyridol with nitric acid in the pr...

Compound Q&A

What precautions should be taken when handling 2-Nitro-3-pyridinol (CAS: 15128-08-2)?

When handling 2-Nitro-3-pyridinol (CAS: 15128-08-2), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...