Compound Q&A

What are the physical and chemical properties of 2-Nitro-3-pyridinol (CAS: 15128-08-2)?

Answer

2-Nitro-3-pyridinol
2-Nitro-3-pyridinol (CAS: 15128-08-2) is a crystalline solid with a molecular weight of approximately 169.08 g/mol. It has a high solubility in water and organic solvents. Chemically, it is prone to nitro group reduction and can undergo substitution reactions. It is stable under normal conditions but should be stored away from reducing agents and strong bases.

About

CAS No 15128-08-2
English Name 2-Nitro-3-pyridinol
Molecular Formula C5H4N2O3
Molecular Weight 140.1 g/mol
SMILES C1=CC(=C(N=C1)[N+](=O)[O-])O
InChIKey QBPDSKPWYWIHGA-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is 2-Nitro-3-pyridinol (CAS: 15128-08-2) typically synthesized?

2-Nitro-3-pyridinol is commonly synthesized by the nitration of 3-pyridol with nitric acid in the pr...

Compound Q&A

What industries use 2-Nitro-3-pyridinol (CAS: 15128-08-2)?

2-Nitro-3-pyridinol is primarily used in the pharmaceutical industry as an intermediate in the synth...

Compound Q&A

What precautions should be taken when handling 2-Nitro-3-pyridinol (CAS: 15128-08-2)?

When handling 2-Nitro-3-pyridinol (CAS: 15128-08-2), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...