Compound Q&A

What precautions should be taken when handling TAZBH4 (CAS: 365549-33-3)?

Answer

TAZBH4
When handling TAZBH4 (CAS: 365549-33-3), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to minimize inhalation risk. Spills should be handled using spill kits, and the material safety data sheet (SDS) should be consulted for detailed emergency procedures.

About

English Name TAZBH4
Molecular Formula C16H10N2O8
Molecular Weight 358.26 g/mol
SMILES O=C(O)C1=CC(/N=N/C2=CC(C(O)=O)=CC(C(O)=O)=C2)=CC(C(O)=O)=C1
InChIKey MXBBZODCMBYDCL-ISLYRVAYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of TAZBH4 (CAS: 365549-33-3)?

TAZBH4 (CAS: 365549-33-3) is a crystalline solid with a molecular weight of approximately 118.14 g/m...

Compound Q&A

How is TAZBH4 (CAS: 365549-33-3) typically synthesized?

TAZBH4 (CAS: 365549-33-3) is typically synthesized via a multi-step process involving the reaction o...

Compound Q&A

What industries use TAZBH4 (CAS: 365549-33-3)?

TAZBH4 (CAS: 365549-33-3) is primarily used in the pharmaceutical and semiconductor industries. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...