Compound Q&A

What are the physical and chemical properties of TAZBH4 (CAS: 365549-33-3)?

Answer

TAZBH4
TAZBH4 (CAS: 365549-33-3) is a crystalline solid with a molecular weight of approximately 118.14 g/mol. It has a low solubility in water but is more soluble in organic solvents. TAZBH4 exhibits good thermal stability but is reactive with strong acids and bases. It is typically used in the synthesis of other compounds due to its reactivity.

About

English Name TAZBH4
Molecular Formula C16H10N2O8
Molecular Weight 358.26 g/mol
SMILES O=C(O)C1=CC(/N=N/C2=CC(C(O)=O)=CC(C(O)=O)=C2)=CC(C(O)=O)=C1
InChIKey MXBBZODCMBYDCL-ISLYRVAYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is TAZBH4 (CAS: 365549-33-3) typically synthesized?

TAZBH4 (CAS: 365549-33-3) is typically synthesized via a multi-step process involving the reaction o...

Compound Q&A

What industries use TAZBH4 (CAS: 365549-33-3)?

TAZBH4 (CAS: 365549-33-3) is primarily used in the pharmaceutical and semiconductor industries. It s...

Compound Q&A

What precautions should be taken when handling TAZBH4 (CAS: 365549-33-3)?

When handling TAZBH4 (CAS: 365549-33-3), it is essential to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...