Compound Q&A

What industries use TAZBH4 (CAS: 365549-33-3)?

Answer

TAZBH4
TAZBH4 (CAS: 365549-33-3) is primarily used in the pharmaceutical and semiconductor industries. It serves as a key intermediate in the synthesis of various pharmaceuticals and is also utilized in the fabrication of certain semiconductor materials.

About

English Name TAZBH4
Molecular Formula C16H10N2O8
Molecular Weight 358.26 g/mol
SMILES O=C(O)C1=CC(/N=N/C2=CC(C(O)=O)=CC(C(O)=O)=C2)=CC(C(O)=O)=C1
InChIKey MXBBZODCMBYDCL-ISLYRVAYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of TAZBH4 (CAS: 365549-33-3)?

TAZBH4 (CAS: 365549-33-3) is a crystalline solid with a molecular weight of approximately 118.14 g/m...

Compound Q&A

How is TAZBH4 (CAS: 365549-33-3) typically synthesized?

TAZBH4 (CAS: 365549-33-3) is typically synthesized via a multi-step process involving the reaction o...

Compound Q&A

What precautions should be taken when handling TAZBH4 (CAS: 365549-33-3)?

When handling TAZBH4 (CAS: 365549-33-3), it is essential to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...