Compound Q&A

What industries use 3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid (CAS: 886362-00-1)?

Answer

3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid
3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid is primarily used in pharmaceutical research for the development of new drugs and in the synthesis of chemical intermediates. It also finds applications in the field of materials science, particularly in the development of sensors and semiconductors due to its unique electronic properties.

About

English Name 3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES C1=CC2=NC=C(N2C=C1C(=O)O)Br
InChIKey VLYJTINXFYEGOO-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid (CAS: 886362-00-1)?

3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid (CAS: 886362-00-1) typically synthesized?

3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid can be synthesized via bromination of 6-carboxy-3-im...

Compound Q&A

What precautions should be taken when handling 3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid (CAS: 886362-00-1)?

When handling 3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid, it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...