Compound Q&A

How is 3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid (CAS: 886362-00-1) typically synthesized?

Answer

3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid
3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid can be synthesized via bromination of 6-carboxy-3-imidazo[1,2-a]pyridine using N-bromosuccinimide (NBS) in the presence of a radical initiator like AIBN. The reaction proceeds under UV light and generates a product with a high yield. This method provides a controlled and selective synthesis of the desired compound.

About

English Name 3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES C1=CC2=NC=C(N2C=C1C(=O)O)Br
InChIKey VLYJTINXFYEGOO-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid (CAS: 886362-00-1)?

3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid is a crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid (CAS: 886362-00-1)?

3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid is primarily used in pharmaceutical research for the...

Compound Q&A

What precautions should be taken when handling 3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid (CAS: 886362-00-1)?

When handling 3-Bromoimidazo[1,2-A]pyridine-6-carboxylic acid, it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...