Compound Q&A

How is 2-Bromo-6-methyl-3-nitropyridine (CAS: 374633-31-5) typically synthesized?

Answer

2-Bromo-6-methyl-3-nitropyridine
2-Bromo-6-methyl-3-nitropyridine is typically synthesized via a nitration of 6-methyl-3-pyridylamine followed by bromination. Commonly used reagents include nitric acid and sulfuric acid for nitration, and N-bromosuccinimide (NBS) for bromination. The synthesis yields around 75-80%, with high selectivity and good purity.

About

English Name 2-Bromo-6-methyl-3-nitropyridine
Molecular Formula C6H5BrN2O2
Molecular Weight 217.02 g/mol
SMILES CC1=NC(=C(C=C1)[N+](=O)[O-])Br
InChIKey IHHLJCDGOSZFTB-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-6-methyl-3-nitropyridine (CAS: 374633-31-5)?

2-Bromo-6-methyl-3-nitropyridine is a solid with a crystalline form. Its molecular weight is approxi...

Compound Q&A

What industries use 2-Bromo-6-methyl-3-nitropyridine (CAS: 374633-31-5)?

2-Bromo-6-methyl-3-nitropyridine is used in the pharmaceutical industry as a precursor for certain d...

Compound Q&A

What precautions should be taken when handling 2-Bromo-6-methyl-3-nitropyridine (CAS: 374633-31-5)?

When handling 2-Bromo-6-methyl-3-nitropyridine, it is essential to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...