Compound Q&A

What are the physical and chemical properties of 2-Bromo-6-methyl-3-nitropyridine (CAS: 374633-31-5)?

Answer

2-Bromo-6-methyl-3-nitropyridine
2-Bromo-6-methyl-3-nitropyridine is a solid with a crystalline form. Its molecular weight is approximately 235.03 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. It is moderately reactive, particularly with reducing agents. The compound is stable under normal conditions but should be stored away from moisture and oxidizing agents.

About

English Name 2-Bromo-6-methyl-3-nitropyridine
Molecular Formula C6H5BrN2O2
Molecular Weight 217.02 g/mol
SMILES CC1=NC(=C(C=C1)[N+](=O)[O-])Br
InChIKey IHHLJCDGOSZFTB-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 2-Bromo-6-methyl-3-nitropyridine (CAS: 374633-31-5) typically synthesized?

2-Bromo-6-methyl-3-nitropyridine is typically synthesized via a nitration of 6-methyl-3-pyridylamine...

Compound Q&A

What industries use 2-Bromo-6-methyl-3-nitropyridine (CAS: 374633-31-5)?

2-Bromo-6-methyl-3-nitropyridine is used in the pharmaceutical industry as a precursor for certain d...

Compound Q&A

What precautions should be taken when handling 2-Bromo-6-methyl-3-nitropyridine (CAS: 374633-31-5)?

When handling 2-Bromo-6-methyl-3-nitropyridine, it is essential to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...