Compound Q&A

What industries use 9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride (CAS: 221352-88-1)?

Answer

9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride (1:1)
9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride is used in the pharmaceutical industry for drug synthesis. It also finds applications in polymer chemistry for functionalization and in the semiconductor industry for surface modification. Additionally, it can be used in the development of sensors due to its chemical reactivity.

About

English Name 9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride (1:1)
Molecular Formula C19H23ClN2O3
Molecular Weight 362.85700000000014 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCN.Cl
InChIKey ZRXOWZYREIYUHG-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride (CAS: 221352-88-1)?

9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride has a crystalline form. Its mo...

Compound Q&A

How is 9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride (CAS: 221352-88-1) typically synthesized?

9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride is typically synthesized by re...

Compound Q&A

What precautions should be taken when handling 9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride (CAS: 221352-88-1)?

When handling 9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride, it is important...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...