Compound Q&A

What are the physical and chemical properties of 9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride (CAS: 221352-88-1)?

Answer

9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride (1:1)
9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride has a crystalline form. Its molecular weight is approximately 406.5 g/mol. It is slightly soluble in water and has good solubility in organic solvents like dichloromethane and acetonitrile. This compound is reactive and can undergo hydrolysis under basic conditions. It has a pKa of around 7.5.

About

English Name 9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride (1:1)
Molecular Formula C19H23ClN2O3
Molecular Weight 362.86 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCN.Cl
InChIKey ZRXOWZYREIYUHG-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride (CAS: 221352-88-1) typically synthesized?

9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride is typically synthesized by re...

Compound Q&A

What industries use 9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride (CAS: 221352-88-1)?

9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride is used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride (CAS: 221352-88-1)?

When handling 9H-Fluoren-9-ylmethyl [2-(2-aminoethoxy)ethyl]carbamate hydrochloride, it is important...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...