Compound Q&A

What industries use (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9)?

Answer

(3-Cyanophenoxy)acetic Acid
(3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9) is primarily used in the pharmaceutical industry as an intermediate for the synthesis of herbicides and fungicides. It also finds applications in the polymer industry for the production of certain types of plastics and in the sensor industry for the development of chemical sensors.

About

CAS No 1879-58-9
English Name (3-Cyanophenoxy)acetic Acid
Molecular Formula C9H7NO3
Molecular Weight 166.176 g/mol
SMILES C1=CC(=CC(=C1)OCC(=O)O)C#N
InChIKey UXBVJOUILGIGHW-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9)?

(3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9) is a crystalline solid with a molecular weight of appro...

Compound Q&A

How is (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9) typically synthesized?

(3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9) can be synthesized through a series of reactions starti...

Compound Q&A

What precautions should be taken when handling (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9)?

When handling (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9), it is crucial to wear appropriate person...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...