Compound Q&A

How is (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9) typically synthesized?

Answer

(3-Cyanophenoxy)acetic Acid
(3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9) can be synthesized through a series of reactions starting from phenol and chloroacetic acid. The key steps involve the preparation of 3-chlorophenoxyacetic acid followed by the nucleophilic substitution of the chlorine atom with cyanide. This process typically yields a high purity product with good selectivity and yield.

About

CAS No 1879-58-9
English Name (3-Cyanophenoxy)acetic Acid
Molecular Formula C9H7NO3
Molecular Weight 166.176 g/mol
SMILES C1=CC(=CC(=C1)OCC(=O)O)C#N
InChIKey UXBVJOUILGIGHW-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9)?

(3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9) is a crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9)?

(3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9) is primarily used in the pharmaceutical industry as an ...

Compound Q&A

What precautions should be taken when handling (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9)?

When handling (3-Cyanophenoxy)acetic Acid (CAS: 1879-58-9), it is crucial to wear appropriate person...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...